C9H11FN2O3 — CID 105381967
3-fluoro-2-[2-hydroxyethyl(methyl)amino]pyridine-4-carboxylic acid (PubChem CID 105381967) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is 3-fluoro-2-[2-hydroxyethyl(methyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-[2-hydroxyethyl(methyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105381967 |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-fluoro-2-[2-hydroxyethyl(methyl)amino]pyridine-4-carboxylic acid |
| SMILES | CN(CCO)c1nccc(C(=O)O)c1F |
| InChI | InChI=1S/C9H11FN2O3/c1-12(4-5-13)8-7(10)6(9(14)15)2-3-11-8/h2-3,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | ZSWTUJXNMGBMMG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |