About [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol
[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol (PubChem CID 105382865) has the molecular formula C13H13FN2OS
and a molecular weight of 264.33 g/mol. Its IUPAC name is [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol |
| PubChem CID | 105382865 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol |
| SMILES | OCc1ccnc(N2CCc3sccc3C2)c1F |
| InChI | InChI=1S/C13H13FN2OS/c14-12-10(8-17)1-4-15-13(12)16-5-2-11-9(7-16)3-6-18-11/h1,3-4,6,17H,2,5,7-8H2 |
| InChIKey | CECIHWPCZKSQCT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol?
The IUPAC name of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol (CID 105382865) is [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol.
What is the SMILES notation for [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol?
The canonical SMILES for [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol is OCc1ccnc(N2CCc3sccc3C2)c1F.
What is the InChIKey of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol?
The InChIKey is CECIHWPCZKSQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2OS/c14-12-10(8-17)1-4-15-13(12)16-5-2-11-9(7-16)3-6-18-11/h1,3-4,6,17H,2,5,7-8H2.
What are the key properties of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol?
[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol has a molecular weight of 264.33 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-4-pyridinyl]methanol is sourced from PubChem (CID 105382865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).