C10H14ClFN2O — CID 105383808
2-[[4-(chloromethyl)-3-fluoro-2-pyridinyl]oxy]-N,N-dimethylethanamine (PubChem CID 105383808) has the molecular formula C10H14ClFN2O and a molecular weight of 232.69 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-3-fluoro-2-pyridinyl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[4-(chloromethyl)-3-fluoro-2-pyridinyl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105383808 |
| Molecular Formula | C10H14ClFN2O |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-[[4-(chloromethyl)-3-fluoro-2-pyridinyl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1nccc(CCl)c1F |
| InChI | InChI=1S/C10H14ClFN2O/c1-14(2)5-6-15-10-9(12)8(7-11)3-4-13-10/h3-4H,5-7H2,1-2H3 |
| InChIKey | FSCLZFKFYSGJLM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|