C15H18O3 — CID 10538381
(2S,3aR,7R,7aS)-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione (PubChem CID 10538381) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2S,3aR,7R,7aS)-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione.
| Compound Name | (2S,3aR,7R,7aS)-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 10538381 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (2S,3aR,7R,7aS)-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione |
| SMILES | C=C1COC(=O)[C@@]12C[C@H]1CC=C[C@@H](C)[C@@]1(C)C2=O |
| InChI | InChI=1S/C15H18O3/c1-9-5-4-6-11-7-15(12(16)14(9,11)3)10(2)8-18-13(15)17/h4-5,9,11H,2,6-8H2,1,3H3/t9-,11-,14-,15+/m1/s1 |
| InChIKey | MXQPVCQOJZROAN-VGKMCQHDSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|