C14H18FN5O — CID 105384707
2-(ethylamino)-3-fluoro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide (PubChem CID 105384707) has the molecular formula C14H18FN5O and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105384707 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide |
| SMILES | CCNc1nccc(C(=O)NCCCn2ccnc2)c1F |
| InChI | InChI=1S/C14H18FN5O/c1-2-17-13-12(15)11(4-6-18-13)14(21)19-5-3-8-20-9-7-16-10-20/h4,6-7,9-10H,2-3,5,8H2,1H3,(H,17,18)(H,19,21) |
| InChIKey | GRXDEYXVBJZAOK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|