About (6-methyl-3-pyridinyl) benzenesulfonate
(6-methyl-3-pyridinyl) benzenesulfonate (PubChem CID 10538577) has the molecular formula C12H11NO3S
and a molecular weight of 249.29 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) benzenesulfonate.
Molecular Properties
| Compound Name | (6-methyl-3-pyridinyl) benzenesulfonate |
| PubChem CID | 10538577 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (6-methyl-3-pyridinyl) benzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C12H11NO3S/c1-10-7-8-11(9-13-10)16-17(14,15)12-5-3-2-4-6-12/h2-9H,1H3 |
| InChIKey | MBBOKDVSUQIHFA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-methyl-3-pyridinyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3-pyridinyl) benzenesulfonate?
The IUPAC name of (6-methyl-3-pyridinyl) benzenesulfonate (CID 10538577) is (6-methyl-3-pyridinyl) benzenesulfonate.
What is the SMILES notation for (6-methyl-3-pyridinyl) benzenesulfonate?
The canonical SMILES for (6-methyl-3-pyridinyl) benzenesulfonate is Cc1ccc(OS(=O)(=O)c2ccccc2)cn1.
What is the InChIKey of (6-methyl-3-pyridinyl) benzenesulfonate?
The InChIKey is MBBOKDVSUQIHFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3S/c1-10-7-8-11(9-13-10)16-17(14,15)12-5-3-2-4-6-12/h2-9H,1H3.
What are the key properties of (6-methyl-3-pyridinyl) benzenesulfonate?
(6-methyl-3-pyridinyl) benzenesulfonate has a molecular weight of 249.29 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3-pyridinyl) benzenesulfonate is sourced from PubChem (CID 10538577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).