About CID 10538595
CID 10538595 (PubChem CID 10538595) has the molecular formula C10H21N2O3S
and a molecular weight of 249.36 g/mol.
Molecular Properties
| Compound Name | CID 10538595 |
| PubChem CID | 10538595 |
| Molecular Formula | C10H21N2O3S |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NS(C)(=O)=O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C10H21N2O3S/c1-9(2)6-8(11-16(5,14)15)7-10(3,4)12(9)13/h8,11H,6-7H2,1-5H3 |
| InChIKey | APSIYPXTNSNMLB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 10538595 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10538595?
The IUPAC name of CID 10538595 (CID 10538595) is not available.
What is the SMILES notation for CID 10538595?
The canonical SMILES for CID 10538595 is CC1(C)CC(NS(C)(=O)=O)CC(C)(C)N1[O].
What is the InChIKey of CID 10538595?
The InChIKey is APSIYPXTNSNMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N2O3S/c1-9(2)6-8(11-16(5,14)15)7-10(3,4)12(9)13/h8,11H,6-7H2,1-5H3.
What are the key properties of CID 10538595?
CID 10538595 has a molecular weight of 249.36 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10538595 is sourced from PubChem (CID 10538595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).