C8H5F7O — CID 10538612
(1S,4R,5R,6R)-5-fluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 10538612) has the molecular formula C8H5F7O and a molecular weight of 250.11 g/mol. Its IUPAC name is (1S,4R,5R,6R)-5-fluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5R,6R)-5-fluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10538612 |
| Molecular Formula | C8H5F7O |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (1S,4R,5R,6R)-5-fluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)[C@@H]1[C@@H]2C=C[C@@H](O2)[C@@]1(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F7O/c9-6(8(13,14)15)4-2-1-3(16-4)5(6)7(10,11)12/h1-5H/t3-,4+,5+,6-/m0/s1 |
| InChIKey | AVGYWBXLVJDBDQ-KCDKBNATSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|