C16H23LiN2 — CID 10538640
lithium (1R,5S)-3-methyl-7-[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane (PubChem CID 10538640) has the molecular formula C16H23LiN2 and a molecular weight of 250.32 g/mol. Its IUPAC name is lithium (1R,5S)-3-methyl-7-[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane.
| Compound Name | lithium (1R,5S)-3-methyl-7-[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 10538640 |
| Molecular Formula | C16H23LiN2 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | lithium (1R,5S)-3-methyl-7-[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane |
| SMILES | C[C@@H](c1[c-]cccc1)N1C[C@@H]2C[C@@H](CN(C)C2)C1.[Li+] |
| InChI | InChI=1S/C16H23N2.Li/c1-13(16-6-4-3-5-7-16)18-11-14-8-15(12-18)10-17(2)9-14;/h3-6,13-15H,8-12H2,1-2H3;/q-1;+1/t13-,14-,15+;/m0./s1 |
| InChIKey | WOYLWNDADPLJMW-UEHWSTJSSA-N |
| XLogP | -0.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|