About 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol
5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol (PubChem CID 10538648) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol.
Molecular Properties
| Compound Name | 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol |
| PubChem CID | 10538648 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol |
| SMILES | COC1CC(O)(CCc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C15H22O3/c1-14(2)15(16,11-13(17-3)18-14)10-9-12-7-5-4-6-8-12/h4-8,13,16H,9-11H2,1-3H3 |
| InChIKey | UOFVQYXPYWRWJJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol?
The IUPAC name of 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol (CID 10538648) is 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol.
What is the SMILES notation for 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol?
The canonical SMILES for 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol is COC1CC(O)(CCc2ccccc2)C(C)(C)O1.
What is the InChIKey of 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol?
The InChIKey is UOFVQYXPYWRWJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-14(2)15(16,11-13(17-3)18-14)10-9-12-7-5-4-6-8-12/h4-8,13,16H,9-11H2,1-3H3.
What are the key properties of 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol?
5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol has a molecular weight of 250.34 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,2-dimethyl-3-(2-phenylethyl)oxolan-3-ol is sourced from PubChem (CID 10538648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).