C13H17NO4 — CID 10538700
ethyl (2S)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10538700) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is ethyl (2S)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl (2S)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10538700 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | ethyl (2S)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c1-3-17-12(15)10(2)14-13(16)18-9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3,(H,14,16)/t10-/m0/s1 |
| InChIKey | LPVIAWIIPLTGFK-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |