C16H22FN3O — CID 105387091
3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[3-fluoro-2-(propylamino)-4-pyridinyl]methanone (PubChem CID 105387091) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[3-fluoro-2-(propylamino)-4-pyridinyl]methanone.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[3-fluoro-2-(propylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 105387091 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[3-fluoro-2-(propylamino)-4-pyridinyl]methanone |
| SMILES | CCCNc1nccc(C(=O)N2CC3CCCC3C2)c1F |
| InChI | InChI=1S/C16H22FN3O/c1-2-7-18-15-14(17)13(6-8-19-15)16(21)20-9-11-4-3-5-12(11)10-20/h6,8,11-12H,2-5,7,9-10H2,1H3,(H,18,19) |
| InChIKey | VIIVEPVIGMQKDW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |