C12H18FN3O2S — CID 105387416
3-fluoro-N-(2-methylsulfinylethyl)-2-(propylamino)pyridine-4-carboxamide (PubChem CID 105387416) has the molecular formula C12H18FN3O2S and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-fluoro-N-(2-methylsulfinylethyl)-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-(2-methylsulfinylethyl)-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387416 |
| Molecular Formula | C12H18FN3O2S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-fluoro-N-(2-methylsulfinylethyl)-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1nccc(C(=O)NCCS(C)=O)c1F |
| InChI | InChI=1S/C12H18FN3O2S/c1-3-5-14-11-10(13)9(4-6-15-11)12(17)16-7-8-19(2)18/h4,6H,3,5,7-8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | GPNJYOUONRFQSP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |