C11H16FN3O2S — CID 105387484
2-amino-3-fluoro-N-(4-methylsulfinylbutan-2-yl)pyridine-4-carboxamide (PubChem CID 105387484) has the molecular formula C11H16FN3O2S and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-(4-methylsulfinylbutan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-amino-3-fluoro-N-(4-methylsulfinylbutan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387484 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-amino-3-fluoro-N-(4-methylsulfinylbutan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(CCS(C)=O)NC(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C11H16FN3O2S/c1-7(4-6-18(2)17)15-11(16)8-3-5-14-10(13)9(8)12/h3,5,7H,4,6H2,1-2H3,(H2,13,14)(H,15,16) |
| InChIKey | QGBMXJRDEZCUBS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |