C13H18FN3O2 — CID 105387635
3-fluoro-2-(methylamino)-N-[1-(oxolan-3-yl)ethyl]pyridine-4-carboxamide (PubChem CID 105387635) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-[1-(oxolan-3-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-[1-(oxolan-3-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387635 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-[1-(oxolan-3-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NC(C)C2CCOC2)c1F |
| InChI | InChI=1S/C13H18FN3O2/c1-8(9-4-6-19-7-9)17-13(18)10-3-5-16-12(15-2)11(10)14/h3,5,8-9H,4,6-7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | CSARPGFQOVRYOD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |