C15H14N2O2 — CID 10538869
7-benzyl-5,6-dihydro-1H-pyrrolo[2,3-c]azepine-4,8-dione (PubChem CID 10538869) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 7-benzyl-5,6-dihydro-1H-pyrrolo[2,3-c]azepine-4,8-dione.
| Compound Name | 7-benzyl-5,6-dihydro-1H-pyrrolo[2,3-c]azepine-4,8-dione |
|---|---|
| PubChem CID | 10538869 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 7-benzyl-5,6-dihydro-1H-pyrrolo[2,3-c]azepine-4,8-dione |
| SMILES | O=C1CCN(Cc2ccccc2)C(=O)c2[nH]ccc21 |
| InChI | InChI=1S/C15H14N2O2/c18-13-7-9-17(10-11-4-2-1-3-5-11)15(19)14-12(13)6-8-16-14/h1-6,8,16H,7,9-10H2 |
| InChIKey | JSFSFJJWASNZPR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |