C14H23FN4 — CID 105389734
3-fluoro-N-methyl-4-(methylaminomethyl)-N-(1-methylpiperidin-3-yl)pyridin-2-amine (PubChem CID 105389734) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-fluoro-N-methyl-4-(methylaminomethyl)-N-(1-methylpiperidin-3-yl)pyridin-2-amine.
| Compound Name | 3-fluoro-N-methyl-4-(methylaminomethyl)-N-(1-methylpiperidin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 105389734 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3-fluoro-N-methyl-4-(methylaminomethyl)-N-(1-methylpiperidin-3-yl)pyridin-2-amine |
| SMILES | CNCc1ccnc(N(C)C2CCCN(C)C2)c1F |
| InChI | InChI=1S/C14H23FN4/c1-16-9-11-6-7-17-14(13(11)15)19(3)12-5-4-8-18(2)10-12/h6-7,12,16H,4-5,8-10H2,1-3H3 |
| InChIKey | RAKOQEZRAOPPOQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |