C15H22FN3 — CID 105390394
N-[[2-(3-ethylpyrrolidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 105390394) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is N-[[2-(3-ethylpyrrolidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(3-ethylpyrrolidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 105390394 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | N-[[2-(3-ethylpyrrolidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | CCC1CCN(c2nccc(CNC3CC3)c2F)C1 |
| InChI | InChI=1S/C15H22FN3/c1-2-11-6-8-19(10-11)15-14(16)12(5-7-17-15)9-18-13-3-4-13/h5,7,11,13,18H,2-4,6,8-10H2,1H3 |
| InChIKey | HTVNXSOQPRLZRQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |