C14H22FN3 — CID 105390409
3-fluoro-N-methyl-N-(2-methylprop-2-enyl)-4-[(propan-2-ylamino)methyl]pyridin-2-amine (PubChem CID 105390409) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-(2-methylprop-2-enyl)-4-[(propan-2-ylamino)methyl]pyridin-2-amine.
| Compound Name | 3-fluoro-N-methyl-N-(2-methylprop-2-enyl)-4-[(propan-2-ylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105390409 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 3-fluoro-N-methyl-N-(2-methylprop-2-enyl)-4-[(propan-2-ylamino)methyl]pyridin-2-amine |
| SMILES | C=C(C)CN(C)c1nccc(CNC(C)C)c1F |
| InChI | InChI=1S/C14H22FN3/c1-10(2)9-18(5)14-13(15)12(6-7-16-14)8-17-11(3)4/h6-7,11,17H,1,8-9H2,2-5H3 |
| InChIKey | PJDYRGRBTUDPDY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|