C10H11FN4 — CID 105390553
1-(3-fluoro-2-pyrazol-1-yl-4-pyridinyl)-N-methylmethanamine (PubChem CID 105390553) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyrazol-1-yl-4-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-(3-fluoro-2-pyrazol-1-yl-4-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105390553 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 1-(3-fluoro-2-pyrazol-1-yl-4-pyridinyl)-N-methylmethanamine |
| SMILES | CNCc1ccnc(-n2cccn2)c1F |
| InChI | InChI=1S/C10H11FN4/c1-12-7-8-3-5-13-10(9(8)11)15-6-2-4-14-15/h2-6,12H,7H2,1H3 |
| InChIKey | LQHMGGXAFIKOHK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |