C16H21FN2OS — CID 105391410
N-[[3-fluoro-2-(2-thiophen-2-ylethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine (PubChem CID 105391410) has the molecular formula C16H21FN2OS and a molecular weight of 308.42 g/mol. Its IUPAC name is N-[[3-fluoro-2-(2-thiophen-2-ylethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-fluoro-2-(2-thiophen-2-ylethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 105391410 |
| Molecular Formula | C16H21FN2OS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[[3-fluoro-2-(2-thiophen-2-ylethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccnc(OCCc2cccs2)c1F |
| InChI | InChI=1S/C16H21FN2OS/c1-12(2)10-18-11-13-5-7-19-16(15(13)17)20-8-6-14-4-3-9-21-14/h3-5,7,9,12,18H,6,8,10-11H2,1-2H3 |
| InChIKey | VACNPUPWGQTXOG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |