C15H18N2O2 — CID 10539146
(1S,2S,6R,7R)-5-(2,4,6-trimethylphenyl)-3,9-dioxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 10539146) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1S,2S,6R,7R)-5-(2,4,6-trimethylphenyl)-3,9-dioxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-ene.
| Compound Name | (1S,2S,6R,7R)-5-(2,4,6-trimethylphenyl)-3,9-dioxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-ene |
|---|---|
| PubChem CID | 10539146 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1S,2S,6R,7R)-5-(2,4,6-trimethylphenyl)-3,9-dioxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | Cc1cc(C)c(C2=NO[C@H]3[C@@H]2[C@H]2C[C@@H]3ON2)c(C)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-7-4-8(2)12(9(3)5-7)14-13-10-6-11(18-16-10)15(13)19-17-14/h4-5,10-11,13,15-16H,6H2,1-3H3/t10-,11+,13-,15-/m1/s1 |
| InChIKey | PBVDXMPQUWTKGI-NDPMZMCLSA-N |
| XLogP | 2.01 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |