C15H15ClF2N2O — CID 105391755
N-[[2-(3-chloro-2-fluorophenoxy)-3-fluoro-4-pyridinyl]methyl]propan-2-amine (PubChem CID 105391755) has the molecular formula C15H15ClF2N2O and a molecular weight of 312.75 g/mol. Its IUPAC name is N-[[2-(3-chloro-2-fluorophenoxy)-3-fluoro-4-pyridinyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(3-chloro-2-fluorophenoxy)-3-fluoro-4-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 105391755 |
| Molecular Formula | C15H15ClF2N2O |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[[2-(3-chloro-2-fluorophenoxy)-3-fluoro-4-pyridinyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccnc(Oc2cccc(Cl)c2F)c1F |
| InChI | InChI=1S/C15H15ClF2N2O/c1-9(2)20-8-10-6-7-19-15(13(10)17)21-12-5-3-4-11(16)14(12)18/h3-7,9,20H,8H2,1-2H3 |
| InChIKey | SGOWGYDCJIGADO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |