C13H17FN4O — CID 105391771
N-[[2-(1-ethylpyrazol-4-yl)oxy-3-fluoro-4-pyridinyl]methyl]ethanamine (PubChem CID 105391771) has the molecular formula C13H17FN4O and a molecular weight of 264.30 g/mol. Its IUPAC name is N-[[2-(1-ethylpyrazol-4-yl)oxy-3-fluoro-4-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[2-(1-ethylpyrazol-4-yl)oxy-3-fluoro-4-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105391771 |
| Molecular Formula | C13H17FN4O |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-[[2-(1-ethylpyrazol-4-yl)oxy-3-fluoro-4-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1ccnc(Oc2cnn(CC)c2)c1F |
| InChI | InChI=1S/C13H17FN4O/c1-3-15-7-10-5-6-16-13(12(10)14)19-11-8-17-18(4-2)9-11/h5-6,8-9,15H,3-4,7H2,1-2H3 |
| InChIKey | FNPVAUSFNJCHLF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |