C14H23N3O — CID 105391938
(3-cycloheptyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanol (PubChem CID 105391938) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (3-cycloheptyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanol.
| Compound Name | (3-cycloheptyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanol |
|---|---|
| PubChem CID | 105391938 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (3-cycloheptyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanol |
| SMILES | OCC1CCc2nnc(C3CCCCCC3)n2C1 |
| InChI | InChI=1S/C14H23N3O/c18-10-11-7-8-13-15-16-14(17(13)9-11)12-5-3-1-2-4-6-12/h11-12,18H,1-10H2 |
| InChIKey | QXFLJXGVOIMVFW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |