C10H17N3O3S — CID 105391972
[3-(1-methylsulfonylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol (PubChem CID 105391972) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is [3-(1-methylsulfonylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol.
| Compound Name | [3-(1-methylsulfonylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 105391972 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [3-(1-methylsulfonylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
| SMILES | CC(c1nnc2n1CC(CO)CC2)S(C)(=O)=O |
| InChI | InChI=1S/C10H17N3O3S/c1-7(17(2,15)16)10-12-11-9-4-3-8(6-14)5-13(9)10/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | SMIFTRYTQKONPK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |