C9H15N3O3S — CID 105392048
[3-(methylsulfonylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol (PubChem CID 105392048) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is [3-(methylsulfonylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol.
| Compound Name | [3-(methylsulfonylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 105392048 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [3-(methylsulfonylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
| SMILES | CS(=O)(=O)Cc1nnc2n1CC(CO)CC2 |
| InChI | InChI=1S/C9H15N3O3S/c1-16(14,15)6-9-11-10-8-3-2-7(5-13)4-12(8)9/h7,13H,2-6H2,1H3 |
| InChIKey | OWHDKBATFYGJBP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |