C15H18N4O — CID 105392131
[3-(1,3-dihydro-2-benzofuran-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine (PubChem CID 105392131) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is [3-(1,3-dihydro-2-benzofuran-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine.
| Compound Name | [3-(1,3-dihydro-2-benzofuran-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 105392131 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [3-(1,3-dihydro-2-benzofuran-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
| SMILES | NCC1CCc2nnc(-c3ccc4c(c3)COC4)n2C1 |
| InChI | InChI=1S/C15H18N4O/c16-6-10-1-4-14-17-18-15(19(14)7-10)11-2-3-12-8-20-9-13(12)5-11/h2-3,5,10H,1,4,6-9,16H2 |
| InChIKey | OLDNBAICCFOIKS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |