C9H3F5N4 — CID 105392749
3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile (PubChem CID 105392749) has the molecular formula C9H3F5N4 and a molecular weight of 262.14 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 105392749 |
| Molecular Formula | C9H3F5N4 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile |
| SMILES | N#Cc1ccc2nnc(C(F)(F)C(F)(F)F)n2c1 |
| InChI | InChI=1S/C9H3F5N4/c10-8(11,9(12,13)14)7-17-16-6-2-1-5(3-15)4-18(6)7/h1-2,4H |
| InChIKey | FOFOBLPQSHLWNN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|