C16H16Cl2FN — CID 105394689
1-(2-chloro-5-fluorophenyl)-2-(3-chlorophenyl)-N-ethylethanamine (PubChem CID 105394689) has the molecular formula C16H16Cl2FN and a molecular weight of 312.22 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-2-(3-chlorophenyl)-N-ethylethanamine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-2-(3-chlorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 105394689 |
| Molecular Formula | C16H16Cl2FN |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-2-(3-chlorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cccc(Cl)c1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C16H16Cl2FN/c1-2-20-16(9-11-4-3-5-12(17)8-11)14-10-13(19)6-7-15(14)18/h3-8,10,16,20H,2,9H2,1H3 |
| InChIKey | MHOYIDOVGXBFRF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |