C10H13ClFNS — CID 105394877
1-(2-chloro-5-fluorophenyl)-N-methyl-2-methylsulfanylethanamine (PubChem CID 105394877) has the molecular formula C10H13ClFNS and a molecular weight of 233.74 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-N-methyl-2-methylsulfanylethanamine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-N-methyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 105394877 |
| Molecular Formula | C10H13ClFNS |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-N-methyl-2-methylsulfanylethanamine |
| SMILES | CNC(CSC)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C10H13ClFNS/c1-13-10(6-14-2)8-5-7(12)3-4-9(8)11/h3-5,10,13H,6H2,1-2H3 |
| InChIKey | MIKLOOVWALEKAS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |