C15H21NO3 — CID 10539494
N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]butanamide (PubChem CID 10539494) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]butanamide.
| Compound Name | N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]butanamide |
|---|---|
| PubChem CID | 10539494 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]butanamide |
| SMILES | CCCC(=O)N[C@@H](CO)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-2-6-15(19)16-13(11-17)14(18)10-9-12-7-4-3-5-8-12/h3-5,7-10,13-14,17-18H,2,6,11H2,1H3,(H,16,19)/b10-9+/t13-,14+/m0/s1 |
| InChIKey | HUGXFFYPPRXZGA-XACNLCELSA-N |
| XLogP | 1.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |