C11H20O7 — CID 10539526
(1R,2S,3R,6R)-6-(methoxymethoxy)-5-(methoxymethoxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 10539526) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is (1R,2S,3R,6R)-6-(methoxymethoxy)-5-(methoxymethoxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2S,3R,6R)-6-(methoxymethoxy)-5-(methoxymethoxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 10539526 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1R,2S,3R,6R)-6-(methoxymethoxy)-5-(methoxymethoxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | COCOCC1=C[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1OCOC |
| InChI | InChI=1S/C11H20O7/c1-15-5-17-4-7-3-8(12)9(13)10(14)11(7)18-6-16-2/h3,8-14H,4-6H2,1-2H3/t8-,9+,10-,11-/m1/s1 |
| InChIKey | ZUSWQYUZFPJKMX-LMLFDSFASA-N |
| XLogP | -1.38 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|