C15H24O2Si — CID 10539583
(1R,3S,7R,8S)-8-methyl-3-trimethylsilyloxytricyclo[5.3.1.03,8]undec-5-en-2-one (PubChem CID 10539583) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is (1R,3S,7R,8S)-8-methyl-3-trimethylsilyloxytricyclo[5.3.1.03,8]undec-5-en-2-one.
| Compound Name | (1R,3S,7R,8S)-8-methyl-3-trimethylsilyloxytricyclo[5.3.1.03,8]undec-5-en-2-one |
|---|---|
| PubChem CID | 10539583 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1R,3S,7R,8S)-8-methyl-3-trimethylsilyloxytricyclo[5.3.1.03,8]undec-5-en-2-one |
| SMILES | C[C@]12CC[C@@H]3C[C@@H]1C=CC[C@@]2(O[Si](C)(C)C)C3=O |
| InChI | InChI=1S/C15H24O2Si/c1-14-9-7-11-10-12(14)6-5-8-15(14,13(11)16)17-18(2,3)4/h5-6,11-12H,7-10H2,1-4H3/t11-,12+,14+,15-/m1/s1 |
| InChIKey | YMBPPESUNYVAQX-PAPYEOQZSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|