C18H21NO — CID 10539775
(2S,3S)-5,5-dimethyl-2,3-diphenylmorpholine (PubChem CID 10539775) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (2S,3S)-5,5-dimethyl-2,3-diphenylmorpholine.
| Compound Name | (2S,3S)-5,5-dimethyl-2,3-diphenylmorpholine |
|---|---|
| PubChem CID | 10539775 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (2S,3S)-5,5-dimethyl-2,3-diphenylmorpholine |
| SMILES | CC1(C)CO[C@@H](c2ccccc2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C18H21NO/c1-18(2)13-20-17(15-11-7-4-8-12-15)16(19-18)14-9-5-3-6-10-14/h3-12,16-17,19H,13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | ZHKKIXILAABIPQ-IRXDYDNUSA-N |
| XLogP | 3.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |