C14H20O5 — CID 10539824
(1S,2R,3S,4S,6R,7R)-1-methyl-3-pentanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde (PubChem CID 10539824) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,2R,3S,4S,6R,7R)-1-methyl-3-pentanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde.
| Compound Name | (1S,2R,3S,4S,6R,7R)-1-methyl-3-pentanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
|---|---|
| PubChem CID | 10539824 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1S,2R,3S,4S,6R,7R)-1-methyl-3-pentanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
| SMILES | CCCCC(=O)[C@@H]1[C@H]2[C@@H](C[C@@H]1C=O)[C@H]1OO[C@]2(C)O1 |
| InChI | InChI=1S/C14H20O5/c1-3-4-5-10(16)11-8(7-15)6-9-12(11)14(2)17-13(9)18-19-14/h7-9,11-13H,3-6H2,1-2H3/t8-,9-,11-,12-,13-,14+/m1/s1 |
| InChIKey | ICRFVSDQQRXXCK-ZZWKFIDSSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|