C15H13BrClF2NO — CID 105398813
1-(4-bromo-5-chloro-2-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)-N-methylmethanamine (PubChem CID 105398813) has the molecular formula C15H13BrClF2NO and a molecular weight of 376.63 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105398813 |
| Molecular Formula | C15H13BrClF2NO |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(OC)c(F)c1)c1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C15H13BrClF2NO/c1-20-15(8-3-4-14(21-2)13(19)5-8)9-6-11(17)10(16)7-12(9)18/h3-7,15,20H,1-2H3 |
| InChIKey | DJTBGKJOZRKXGW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|