C14H28N2OSi — CID 10539885
tert-butyl-[(3R,5S)-5-(2,5-dihydro-1H-pyrrol-3-yl)pyrrolidin-3-yl]oxy-dimethylsilane (PubChem CID 10539885) has the molecular formula C14H28N2OSi and a molecular weight of 268.48 g/mol. Its IUPAC name is tert-butyl-[(3R,5S)-5-(2,5-dihydro-1H-pyrrol-3-yl)pyrrolidin-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,5S)-5-(2,5-dihydro-1H-pyrrol-3-yl)pyrrolidin-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10539885 |
| Molecular Formula | C14H28N2OSi |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | tert-butyl-[(3R,5S)-5-(2,5-dihydro-1H-pyrrol-3-yl)pyrrolidin-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CN[C@H](C2=CCNC2)C1 |
| InChI | InChI=1S/C14H28N2OSi/c1-14(2,3)18(4,5)17-12-8-13(16-10-12)11-6-7-15-9-11/h6,12-13,15-16H,7-10H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | SFPLVFVEROZUJO-OLZOCXBDSA-N |
| XLogP | 2.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|