C14H28BNO3 — CID 10539895
(Z)-N-methoxy-4,4-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-imine (PubChem CID 10539895) has the molecular formula C14H28BNO3 and a molecular weight of 269.19 g/mol. Its IUPAC name is (Z)-N-methoxy-4,4-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-imine.
| Compound Name | (Z)-N-methoxy-4,4-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-imine |
|---|---|
| PubChem CID | 10539895 |
| Molecular Formula | C14H28BNO3 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | (Z)-N-methoxy-4,4-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-3-imine |
| SMILES | CO/N=C(/CCB1OC(C)(C)C(C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C14H28BNO3/c1-12(2,3)11(16-17-8)9-10-15-18-13(4,5)14(6,7)19-15/h9-10H2,1-8H3/b16-11- |
| InChIKey | HNCMWYVACFPHNO-WJDWOHSUSA-N |
| XLogP | 3.52 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|