C14H23NO4 — CID 10539924
[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-2H-furan-5-yl)methanone (PubChem CID 10539924) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is [(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-2H-furan-5-yl)methanone.
| Compound Name | [(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-2H-furan-5-yl)methanone |
|---|---|
| PubChem CID | 10539924 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-2H-furan-5-yl)methanone |
| SMILES | COC[C@@H]1CC[C@@H](COC)N1C(=O)C1(C)C=CCO1 |
| InChI | InChI=1S/C14H23NO4/c1-14(7-4-8-19-14)13(16)15-11(9-17-2)5-6-12(15)10-18-3/h4,7,11-12H,5-6,8-10H2,1-3H3/t11-,12-,14?/m0/s1 |
| InChIKey | JALMYFLHQIUVRI-VHBIQUBJSA-N |
| XLogP | 0.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|