C15H11ClN2O — CID 10540006
2-(3-chlorophenyl)-6-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 10540006) has the molecular formula C15H11ClN2O and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(3-chlorophenyl)-6-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 10540006 |
| Molecular Formula | C15H11ClN2O |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(3-chlorophenyl)-6-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccc2nc(-c3cccc(Cl)c3)cc(=O)n12 |
| InChI | InChI=1S/C15H11ClN2O/c1-10-4-2-7-14-17-13(9-15(19)18(10)14)11-5-3-6-12(16)8-11/h2-9H,1H3 |
| InChIKey | YQEFJXMTIUHWRH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |