C16H13F2NO — CID 105402704
3-[1-(3,5-difluorophenyl)-2-hydroxypropan-2-yl]benzonitrile (PubChem CID 105402704) has the molecular formula C16H13F2NO and a molecular weight of 273.28 g/mol. Its IUPAC name is 3-[1-(3,5-difluorophenyl)-2-hydroxypropan-2-yl]benzonitrile.
| Compound Name | 3-[1-(3,5-difluorophenyl)-2-hydroxypropan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 105402704 |
| Molecular Formula | C16H13F2NO |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[1-(3,5-difluorophenyl)-2-hydroxypropan-2-yl]benzonitrile |
| SMILES | CC(O)(Cc1cc(F)cc(F)c1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H13F2NO/c1-16(20,13-4-2-3-11(5-13)10-19)9-12-6-14(17)8-15(18)7-12/h2-8,20H,9H2,1H3 |
| InChIKey | QHJWUYULPSDMKR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |