About N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine
N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 105402796) has the molecular formula C13H20F2N2
and a molecular weight of 242.31 g/mol. Its IUPAC name is N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine |
| PubChem CID | 105402796 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)N(CCCN)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H20F2N2/c1-10(2)17(5-3-4-16)9-11-6-12(14)8-13(15)7-11/h6-8,10H,3-5,9,16H2,1-2H3 |
| InChIKey | VQVOLDYLDAYENI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
The IUPAC name of N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine (CID 105402796) is N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine.
What is the SMILES notation for N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
The canonical SMILES for N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine is CC(C)N(CCCN)Cc1cc(F)cc(F)c1.
What is the InChIKey of N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
The InChIKey is VQVOLDYLDAYENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2/c1-10(2)17(5-3-4-16)9-11-6-12(14)8-13(15)7-11/h6-8,10H,3-5,9,16H2,1-2H3.
What are the key properties of N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine has a molecular weight of 242.31 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3,5-difluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine is sourced from PubChem (CID 105402796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).