C17H18F2N2 — CID 105402832
4-(aminomethyl)-N-cyclopropyl-N-[(3,5-difluorophenyl)methyl]aniline (PubChem CID 105402832) has the molecular formula C17H18F2N2 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(aminomethyl)-N-cyclopropyl-N-[(3,5-difluorophenyl)methyl]aniline.
| Compound Name | 4-(aminomethyl)-N-cyclopropyl-N-[(3,5-difluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 105402832 |
| Molecular Formula | C17H18F2N2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(aminomethyl)-N-cyclopropyl-N-[(3,5-difluorophenyl)methyl]aniline |
| SMILES | NCc1ccc(N(Cc2cc(F)cc(F)c2)C2CC2)cc1 |
| InChI | InChI=1S/C17H18F2N2/c18-14-7-13(8-15(19)9-14)11-21(17-5-6-17)16-3-1-12(10-20)2-4-16/h1-4,7-9,17H,5-6,10-11,20H2 |
| InChIKey | LWIWLSZIVFTYCQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|