C17H26N2O — CID 10540301
7-tert-butyl-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboximidamide (PubChem CID 10540301) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 7-tert-butyl-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboximidamide.
| Compound Name | 7-tert-butyl-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 10540301 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 7-tert-butyl-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboximidamide |
| SMILES | [H]/N=C(/c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2)N(C)C |
| InChI | InChI=1S/C17H26N2O/c1-16(2,3)12-8-11(15(18)19(6)7)9-13-14(12)20-10-17(13,4)5/h8-9,18H,10H2,1-7H3/b18-15- |
| InChIKey | QPFBMZSZCQHIFS-SDXDJHTJSA-N |
| XLogP | 3.54 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|