About [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol
[2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol (PubChem CID 105403081) has the molecular formula C15H20F3NO
and a molecular weight of 287.32 g/mol. Its IUPAC name is [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol |
| PubChem CID | 105403081 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol |
| SMILES | OCC1(NCC(F)(F)F)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C15H20F3NO/c16-15(17,18)10-19-14(11-20)9-5-4-8-13(14)12-6-2-1-3-7-12/h1-3,6-7,13,19-20H,4-5,8-11H2 |
| InChIKey | SWPYXIRFSKEUDM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol?
The IUPAC name of [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol (CID 105403081) is [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol.
What is the SMILES notation for [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol?
The canonical SMILES for [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol is OCC1(NCC(F)(F)F)CCCCC1c1ccccc1.
What is the InChIKey of [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol?
The InChIKey is SWPYXIRFSKEUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3NO/c16-15(17,18)10-19-14(11-20)9-5-4-8-13(14)12-6-2-1-3-7-12/h1-3,6-7,13,19-20H,4-5,8-11H2.
What are the key properties of [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol?
[2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol has a molecular weight of 287.32 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexyl]methanol is sourced from PubChem (CID 105403081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).