C12H10F2N2O — CID 105403383
3-amino-1-[(3,5-difluorophenyl)methyl]pyridin-2-one (PubChem CID 105403383) has the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. Its IUPAC name is 3-amino-1-[(3,5-difluorophenyl)methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[(3,5-difluorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 105403383 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-amino-1-[(3,5-difluorophenyl)methyl]pyridin-2-one |
| SMILES | Nc1cccn(Cc2cc(F)cc(F)c2)c1=O |
| InChI | InChI=1S/C12H10F2N2O/c13-9-4-8(5-10(14)6-9)7-16-3-1-2-11(15)12(16)17/h1-6H,7,15H2 |
| InChIKey | VYYIGEMFBPGGPF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |