C16H9F2NO2 — CID 105403452
3-[(3,5-difluorophenyl)methoxy]-1-benzofuran-2-carbonitrile (PubChem CID 105403452) has the molecular formula C16H9F2NO2 and a molecular weight of 285.25 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methoxy]-1-benzofuran-2-carbonitrile.
| Compound Name | 3-[(3,5-difluorophenyl)methoxy]-1-benzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 105403452 |
| Molecular Formula | C16H9F2NO2 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methoxy]-1-benzofuran-2-carbonitrile |
| SMILES | N#Cc1oc2ccccc2c1OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H9F2NO2/c17-11-5-10(6-12(18)7-11)9-20-16-13-3-1-2-4-14(13)21-15(16)8-19/h1-7H,9H2 |
| InChIKey | ZCCBQVOIQCIDMB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |