About 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine
3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine (PubChem CID 10540384) has the molecular formula C6H5IN4O
and a molecular weight of 276.04 g/mol. Its IUPAC name is 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 10540384 |
| Molecular Formula | C6H5IN4O |
| Molecular Weight | 276.04 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine |
| SMILES | COc1ncnc2n[nH]c(I)c12 |
| InChI | InChI=1S/C6H5IN4O/c1-12-6-3-4(7)10-11-5(3)8-2-9-6/h2H,1H3,(H,8,9,10,11) |
| InChIKey | FXSGGLZZFMEYOJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.04 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine (CID 10540384) is 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine is COc1ncnc2n[nH]c(I)c12.
What is the InChIKey of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is FXSGGLZZFMEYOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5IN4O/c1-12-6-3-4(7)10-11-5(3)8-2-9-6/h2H,1H3,(H,8,9,10,11).
What are the key properties of 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine?
3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 276.04 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-methoxy-2H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 10540384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).