C14H11F2NO4 — CID 105404143
[3-[(3,5-difluorophenyl)methoxy]-4-nitrophenyl]methanol (PubChem CID 105404143) has the molecular formula C14H11F2NO4 and a molecular weight of 295.24 g/mol. Its IUPAC name is [3-[(3,5-difluorophenyl)methoxy]-4-nitrophenyl]methanol.
| Compound Name | [3-[(3,5-difluorophenyl)methoxy]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 105404143 |
| Molecular Formula | C14H11F2NO4 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [3-[(3,5-difluorophenyl)methoxy]-4-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11F2NO4/c15-11-3-10(4-12(16)6-11)8-21-14-5-9(7-18)1-2-13(14)17(19)20/h1-6,18H,7-8H2 |
| InChIKey | ASZIHEFRAQUBMV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|